Zu "147859-80-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
CA-074 methyl ester
Artikelnummer: TGM-T3420-100mg
Description: CA-074 methyl ester (Cathepsin B Inhibitor IV) is a specific inhibitor of Cathepsin B with neuroprotective, anti-cancer, and anti-inflammatory effects. Target: Cysteine Protease. Smiles: CCCNC(=O)[C@H]1O[C@@H]1C(=O)N[C@@H](C(C)CC)C(=O)N1CCC[C@H]1C(=O)OC. References: Dietmar Steverding, et al. The Open...
| Schlagworte: | Cathepsin B Inhibitor IV, CA-074Me |
| Anwendung: | Cell-permeable cathepsin B / L inhibitor |
| CAS | 147859-80-1 |
| MW: | 397.47 D |
ab 53,00 €
CA-074 methyl ester
Artikelnummer: Cay18469-1
CA-074 methyl ester is a cell-permeable inhibitor of cathepsin B and L in vivo and in whole cells. The methyl ester is hydrolyzed by intracellular esterases releasing the active inhibitor, CA-074. This compound has primarily been used to study the role of cathepsin B in neurodegeneration, cancer cell metastasis,...
| Schlagworte: | N-[[(2S,3S)-3-[(propylamino)carbonyl]-2-oxiranyl]carbonyl]-L-isoleucyl-L-proline, methyl ester |
| Anwendung: | Cell-permeable cathepsin B / L inhibitor |
| CAS | 147859-80-1 |
| MW: | 397.5 D |
ab 84,00 €
