Zu "146670-40-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
NEU
BMS 649
Artikelnummer: Cay30037-10
BMS 649 is a synthetic retinoid and retinoid X receptor (RXR) agonist. It binds to RXRalpha homodimers and selectively induces transactivation in CV-1 cells expressing RXRalpha over CV-1 cells expressing retinoic acid receptor alpha (RARalpha), RARbeta, or RARalpha and RXRalpha when used at a concentration of 0.1...
| Schlagworte: | BMS 188649, SR 11237, UVI 2108, 4-[2-(5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-2-naphthalenyl)-1,3-dioxolan-2-yl]-benzoic acid |
| Anwendung: | Synthetic retinoid, RXR agonist |
| CAS | 146670-40-8 |
| MW: | 380.5 D |
ab 134,00 €
SR11237
Artikelnummer: TGM-T23383-100mg
Description: SR11237 is a Pan retinoid X receptor (RXR) agonist. SR11237 causes RXR/RXR homodimers to form and transactivate a reporter gene containing a RXR-response element. Target: RAR/RXR , Others. Smiles: CC1(C)CCC(C)(C)c2cc(ccc12)C1(OCCO1)c1ccc(cc1)C(O)=O. References: H.L. Dupuis. The RXR agonist SR-11237...
| Schlagworte: | SR 11237 |
| CAS | 146670-40-8 |
| MW: | 380.48 D |
ab 63,00 €
