Zu "146368-13-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
CY3
Artikelnummer: TGM-T18945-10mg
Description: CY3 (Sulfo-Cyanine3) is an orange-fluorescent label for nucleic acids and proteins (lambdaex=554, lambdaem=568). Target: Others. Smiles: C(CCCCC(O)=O)N1C=2C(C(C)(C)C1=CC=CC3=[N+](CC)C=4C(C3(C)C)=CC(S(=O)(=O)[O-])=CC4)=CC(S(=O)(=O)O)=CC2
| Schlagworte: | Sulfo-Cyanine3 |
| CAS | 146368-13-0 |
| MW: | 630.78 D |
ab 57,00 €
Cy3
Artikelnummer: Cay30392-10
Cy3 is a cyanine-containing fluorochrome. It has commonly been conjugated to secondary antibodies for use in immunocytochemistry and immunohistochemistry applications. Cy3 displays excitation/emission maxima of 550/570 nm, respectively.Formal Name:...
| Schlagworte: | 2-[3-[1-(5-carboxypentyl)-1,3-dihydro-3,3-dimethyl-5-sulfo-2H-indol-2-ylidene]-1-propen-1-yl]-1-ethyl-3,3-dimethyl-5-sulfo... |
| Anwendung: | Cyanine-containing fluorochrome |
| CAS | 146368-13-0 |
| MW: | 630.8 D |
ab 61,00 €
