Zu "1456632-40-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
SH-4-54
Artikelnummer: TGM-T6669-100mg
Description: SH-4-54 is a most potent, small molecule, nonphosphorylated STAT3 inhibitor. Target: STAT. Smiles: CN(CC(=O)N(Cc1ccc(cc1)C1CCCCC1)c1ccc(cc1)C(O)=O)S(=O)(=O)c1c(F)c(F)c(F)c(F)c1F. References: Haftchenary S, et al. ACS Med Chem Lett. 2013, 4(11), 1102-1107.
| Anwendung: | STAT3 inhibitor |
| CAS | 1456632-40-8 |
| MW: | 610.59 D |
ab 43,00 €
SH-4-54
Artikelnummer: Cay25982-1
SH-4-54 is an inhibitor of signal transducer and activator of transcription 3 (STAT3, IC50 = 4.7 µM for STAT3 homodimer DNA binding activity). It selectively inhibits STAT3 homodimer over STAT1 and STAT5 homodimer and STAT3:STAT1 heterodimer DNA binding in EGF-stimulated NIH3T3/hEGFR nuclear extracts containing...
| Schlagworte: | 4-[[(4-cyclohexylphenyl)methyl][2-[methyl[(2,3,4,5,6-pentafluorophenyl)sulfonyl]amino]acetyl]amino]-benzoic acid |
| Anwendung: | STAT3 inhibitor |
| CAS | 1456632-40-8 |
| MW: | 610.6 D |
ab 43,00 €
