Zu "144875-48-9" wurden 4 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Resiquimod
Artikelnummer: TGM-T6964-100mg
Description: Resiquimod (R848) is a Toll-like receptor 7/8 (TLR7/TLR8) agonist that induces cytokine upregulation. Resiquimod is an immunomodulator with antitumor and antiviral activity. Target: HCV Protease, TLR. Smiles: CCOCc1nc2c(N)nc3ccccc3c2n1CC(C)(C)O. References: Hemmi H, et al. Nat Immunol. 2002, 3(2),...
| Schlagworte: | S28463, R848 |
| Anwendung: | TLR7 ligand |
| CAS | 144875-48-9 |
| MW: | 314.38 D |
ab 31,00 €
R-848
Artikelnummer: AG-CR1-3582-M005
Synthetic. Immune response modifier. Potent antitumor and antiviral compound. Stimulates antibody secretion and cytokine production. Used as adjuvant to increase the effectiveness of vaccines. Potent and selective synthetic ligand for Toll-like receptor 7 (TLR7) in mouse and for TLR7 and TLR8 in human. Activates...
| Schlagworte: | Resiquimod, S 28463, R848 |
| Anwendung: | TLR7 ligand |
| CAS | 144875-48-9 |
| MW: | 314,4 D |
ab 66,00 €
R-848
Artikelnummer: Cay14806-10
R-848 is an immune response modifier that mimics the pathogen-associated molecular patterns that activate immune cells through Toll-like receptor 7 (TLR7) and TLR8. It demonstrates potent anti-tumor and anti-viral properties and has been used to study the innate immune response to viral infections. At 1 µg/ml,...
| Schlagworte: | Resiquimod, S 28463, 4-amino-2-(ethoxymethyl)-alpha,alpha-dimethyl-1H-imidazo[4,5-c]quinoline-1-ethanol |
| Anwendung: | Immune response modifier, TLR7 / TLR8 PAMP |
| CAS | 144875-48-9 |
| MW: | 314.4 D |
ab 66,00 €
Resiquimod
Artikelnummer: LKT-R183731.10
Toll-like receptor 7/8 agonist
| Schlagworte: | R-848, R848, S28463, alpha-dimethyl-1H-imidazo(4,5-c)quinoline-1-ethanol.,... |
| Anwendung: | Immune response modifier, TLR7 / TLR8 PAMP |
| CAS | 144875-48-9 |
| MW: | 314.39 D |
ab 79,00 €
