Zu "1448316-08-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
BAY-826
Artikelnummer: TGM-T38930-1mg
Description: BAY-826 is a novel, potent and selective TIE-2 inhibitor that inhibits TIE-2 phosphorylation and can be used to study tumors. Target: Tie-2. Smiles: Cc1cc(C)c(cc1NC(=O)c1cc(cc(c1)S(F)(F)(F)(F)F)C#N)-n1ccn2nc(cc12)-c1cccnc1. References: Schneider H,et al. Novel TIE-2 inhibitor BAY-826 displays in vivo...
| Anwendung: | Tie2 inhibitor |
| CAS | 1448316-08-2 |
| MW: | 558.53 D |
69,00 €
BAY-826
Artikelnummer: Cay41365-1
BAY-826 is an inhibitor of tunica interna endothelial cell kinase 2 (Tie2, IC50 = 0.5 nM). It inhibits Tie2 autophosphorylation in human umbilical vein endothelial cells (HUVECs, EC50 = 1.3 nM). BAY-826 (0.1 or 1 µM), in combination with radiation, reduces colony formation in a colony formation assay using SMA-497,...
| Schlagworte: | BAY-Tie2, BAY-Tunica Interna Endothelial Cell Kinase 2,... |
| Anwendung: | Tie2 inhibitor |
| CAS | 1448316-08-2 |
| MW: | 558.5 D |
ab 48,00 €
