Zu "1439399-58-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Telaglenastat
Artikelnummer: TGM-T6797-100mg
Description: Telaglenastat (CB 839) (IC50 of 24 nM), an effective, specific, and oral inhibitor, which is bioavailable glutaminase, for recombinant human GAC. Target: Autophagy, transporter, Glutaminase. Smiles: FC(F)(F)Oc1cccc(CC(=O)Nc2ccc(CCCCc3nnc(NC(=O)Cc4ccccn4)s3)nn2)c1. References: Gross MI, et al....
| Schlagworte: | CB 839, CB839, CB-839 |
| Anwendung: | Targets glutaminase [EC:3.5.1.2] (glsA, GLS) |
| CAS | 1439399-58-2 |
| MW: | 571.57 D |
ab 33,00 €
CB-839
Artikelnummer: Cay22038-5
CB-839 is an orally bioavailable noncompetitive inhibitor of the glutaminase 1 (GLS1) splice variants, kidney-type (KGA) and glutaminase C (GAC), which convert glutamine into glutamate. CB-839 inhibits human recombinant GAC with IC50 values of less than 50 nM, varying based on the length of preincubation. It...
| Schlagworte: | GLS1 Inhibitor III,... |
| Anwendung: | Glutaminase inhibitor |
| CAS | 1439399-58-2 |
| MW: | 571.6 D |
ab 77,00 €
