Zu "1432660-47-3" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
AGI-6780
Artikelnummer: TGM-T1809-100mg
Description: AGI-6780 is a potent and selective inhibitor of IDH2 R140Q mutant. Target: Isocitrate Dehydrogenase (IDH), Dehydrogenase. Smiles: FC(F)(F)c1cccc(NC(=O)Nc2cc(ccc2-c2ccsc2)S(=O)(=O)NC2CC2)c1. References: Wang F, et al. Science. 2013, 340(6132), 622-666.
| Anwendung: | Mutant IDH2 inhibitor |
| CAS | 1432660-47-3 |
| MW: | 481.51 D |
ab 32,00 €
AGI-6780
Artikelnummer: Cay14639-1
Isocitrate dehydrogenases (IDHs) are NAD+ and NADP+-dependent enzymes in the tricarboxylic acid cycle that catalyze oxidative decarboxylation of isocitrate producing alpha-ketoglutarate (2-OG) and carbon dioxide. IDH1 and IDH2 are mutated in >70% of lower grade gliomas. The most common mutations map to arginine...
| Schlagworte: | N-cyclopropyl-4-(3-thienyl)-3-[[[[3-(trifluoromethyl)phenyl]amino]carbonyl]amino]-benzenesulfonamide |
| Anwendung: | Mutant IDH2 inhibitor |
| CAS | 1432660-47-3 |
| MW: | 481.5 D |
ab 60,00 €
AGI-6780
Artikelnummer: LKT-A2532.1
Isocitrate dehydrogenase inhibitor
| Anwendung: | Isocitrate dehydrogenase inhibitor |
| CAS | 1432660-47-3 |
| MW: | 481.51 D |
ab 119,00 €
