Zu "1429-66-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
1,3-Dioctanoyl Glycerol
Artikelnummer: Cay27012-10
1,3-Dioctanoyl glycerol is a diacylglycerol that contains octanoic acid at the sn-1 and sn-3 positions.Formal Name: octanoic acid, 1,1'-(2-hydroxy-1,3-propanediyl) ester. CAS Number: 1429-66-9. Synonyms: DG(8:0/0:0/8:0), 1,3-Dioctanoin. Molecular Formula: C19H36O5. Formula Weight: 344.5. Purity: >95%. Formulation:...
| Schlagworte: | 1,3-Dioctanoin, DG(8:0/0:0/8:0), octanoic acid, 1,1'-(2-hydroxy-1,3-propanediyl) ester |
| Anwendung: | Diacylglycerol |
| CAS | 1429-66-9 |
| MW: | 344.5 D |
ab 58,00 €
1,3-Dioctanoyl Glycerol
Artikelnummer: TGM-T85071-10mg
Description: 1,3-Dioctanoyl glycerol, a diacylglycerol, features octanoic acid at the sn-1 and sn-3 positions. Target: Others. Smiles: CCCCCCCC(=O)OCC(O)COC(=O)CCCCCCC
| Schlagworte: | DG(8:0/0:0/8:0), 1,3-Dioctanoin |
| CAS | 1429-66-9 |
| MW: | 344.492 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
