Zu "1427049-21-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Brexpiprazole-d8
Artikelnummer: TGM-T10610-1mg
Description: Brexpiprazole D8 (OPC-34712 D8) is a deuterium-labeled Brexpiprazole. Brexpiprazole is a partial agonist of human 5-HT1A and dopamine receptors (Ki: 0.12 nM and 0.3 nM). Smiles: C(CCCOC=1C=C2C(=CC1)C=CC(=O)N2)N3C(C(N(C4=C5C(SC=C5)=CC=C4)C(C3([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H]. References: Ishima...
| Schlagworte: | OPC-34712 D8 |
| CAS | 1427049-21-5 |
| MW: | 441.62 D |
ab 508,00 €
Brexpiprazole-d8
Artikelnummer: Cay26450-1
Brexpiprazole-d8 is intended for use as an internal standard for the quantification of brexpiprazole (Cay-22906) by GC- or LC-MS. Brexpiprazole is a serotonin (5-HT) and dopamine receptor modulator that has high affinity (Ki = 1A and 5-HT2A serotonin, dopamine D2L, and alpha1B-, and alpha2C-adrenergic receptors in...
| Schlagworte: | 7-[4-(4-benzo[b]thien-4-yl-1-piperazinyl-2,2,3,3,5,5,6,6-d8)butoxy]-2(1H)-quinolinone |
| Anwendung: | GC-MS, LC-MS, Quantification, Internal standard, Serotonin-dopamine activity modulator (SDAM) |
| CAS | 1427049-21-5 |
| MW: | 441.6 D |
ab 352,00 €
