Zu "1421919-75-6" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
KPT276
Artikelnummer: TGM-T6074-10mg
Description: KPT276 (KPT 276) is an orally bioavailable selective inhibitor of nuclear export (SINE) that irreversibly bind to CRM1 and block the function of CRM1. Target: CRM1. Smiles: FC(F)(F)c1cc(cc(c1)C(F)(F)F)-c1ncn(C=CC(=O)N2CC(F)(F)C2)n1. References: Ranganathan P, et al. Blood. 2012, 120(9), 1765-1773.
| Schlagworte: | KPT-276, KPT 276 |
| Anwendung: | Exportin 1 (XPO1/CRM1) inhibitor, antineoplastic |
| CAS | 1421919-75-6 |
| MW: | 426.26 D |
ab 47,00 €
KPT-276
Artikelnummer: Cay29158-5
KPT-276 is an orally bioavailable inhibitor of Exportin 1 (XPO1/CRM1) with anticancer activity. In vivo, KPT-276 (150 mg/kg) increases survival and reduces spleen weight and white blood cell count in an MV4-11 acute myeloid leukemia (AML) mouse xenograft model. It also reduces tumor volume and increases survival in...
| Schlagworte: | (2Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1H-1,2,4-triazol-1-yl]-1-(3,3-difluoro-1-azetidinyl)-2-propen-1-one |
| Anwendung: | Exportin 1 (XPO1/CRM1) inhibitor, antineoplastic |
| CAS | 1421919-75-6 |
| MW: | 426.3 D |
ab 94,00 €
KPT-276
Artikelnummer: LKT-K624760.1
CRM1/XPO1 inhibitor.
| Schlagworte: | KPT276, (Z)-3-(3-(3,5-bis(trifluoromethyl)phenyl)-1H-1,2,4-triazol-1-yl)-1-(3,3-difluoroazetidin-1-yl)prop-2-en-1-one |
| Anwendung: | CRM1 / XPO1 inhibitor, Nuclear transport inhibitor |
| CAS | 1421919-75-6 |
| MW: | 426.27 D |
ab 95,00 €
