Zu "1418274-28-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Cilofexor
Artikelnummer: TGM-T7436-100mg
Description: Cilofexor inhibits binding of a synthetic peptide, Cilofexor is a farnesoid X receptor (FXR) agonist. Target: Autophagy, FXR. Smiles: OC(=O)c1ccnc(c1)N1CC(O)(C1)c1ccc(OCc2c(onc2-c2c(Cl)cccc2Cl)C2CC2)cc1Cl
| Anwendung: | Farnesoid X receptor (FXR) agonist |
| CAS | 1418274-28-8 |
| MW: | 586.85 D |
ab 46,00 €
Cilofexor
Artikelnummer: Cay25747-1
Cilofexor inhibits binding of a synthetic peptide, comprising residues 676-700 of the steroid receptor coactivator 1 (SRC-1), to the farnesoid X receptor (FXR, EC50 = 50 = >100 nM).Formal Name:...
| Schlagworte: | 2-[3-[2-chloro-4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-4-isoxazolyl]methoxy]phenyl]-3-hydroxy-1-azetidinyl]-4-pyridinecar... |
| Anwendung: | Farnesoid X receptor (FXR) agonist |
| CAS | 1418274-28-8 |
| MW: | 586.9 D |
ab 53,00 €
