Zu "1416153-62-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
SR9238
Artikelnummer: TGM-T16930-10mg
Description: SR9238 is a synthetic agonist of liver X receptor inverse (IC50s: 214 nM and 43 nM for LXRalpha and LXRbeta, respectively). Target: Liver X Receptor. Smiles: CCOC(=O)c1ccc(CN(Cc2ccc(cc2)-c2cccc(c2)S(C)(=O)=O)S(=O)(=O)c2c(C)cc(C)cc2C)o1. References: Griffett K, et al. A liver-selective LXR inverse...
| Anwendung: | LXRA / LXRB inverse agonist |
| CAS | 1416153-62-2 |
| MW: | 595.73 D |
ab 42,00 €
SR9238
Artikelnummer: Cay18771-1
The liver X receptors (LXRs) are nuclear receptors that act as ligand-dependent transcription factors. They modulate lipid, cholesterol, and carbohydrate metabolism and homeostasis. SR9238 is an inverse agonist of the two LXR isoforms, LXRalpha and LXRbeta (IC50s = 214 and 43 nM, respectively). It displays liver...
| Schlagworte: | 5-[[[[3'-(methylsulfonyl)[1,1'-biphenyl]-4-yl]methyl][(2,4,6-trimethylphenyl)sulfonyl]amino]methyl]-2-furancarboxylic... |
| Anwendung: | LXRA / LXRB inverse agonist |
| CAS | 1416153-62-2 |
| MW: | 595.7 D |
ab 45,00 €
