Zu "141206-42-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Lucerastat
Artikelnummer: TGM-T32923-100mg
Description: Lucerastat is a very effective and selective alpha-gal A (alpha-D-galactosidase) inhibitor for the treatment of lipid storage diseases and Fabry disease. Target: Others. Smiles: CCCCN1C[C@H](O)[C@@H](O)[C@@H](O)[C@H]1CO. References: Takai T, Higaki K, Aguilar-Moncayo M, Mena-Barragán T, Hirano Y, Yura...
| Schlagworte: | NBDGJ |
| Anwendung: | Targets ceramide glucosyltransferase [EC:2.4.1.80] (UGCG) |
| CAS | 141206-42-0 |
| MW: | 219.28 D |
ab 764,00 €
N-(n-Butyl)deoxygalactonojirimycin
Artikelnummer: Cay19520-5
N-(n-Butyl)deoxygalactonojirimycin (NB-DGJ) is an inhibitor of the glycolipid biosynthesis enzyme glucosylceramide synthase and the glycolipid catabolic enzymes glucocerebrosidase (GBA) and beta-glucosidase 2 (GBA2). It also inhibits acid alpha-glucosidase, sucrase, maltase, and lactase. NB-DGJ (0.5-500 µM) reduces...
| Schlagworte: | Lucerastat, NBDGJ, 1-butyl-2R-(hydroxymethyl)-3S,4R,5S-piperidinetriol |
| Anwendung: | alpha-D-galactosidase inhibitor |
| CAS | 141206-42-0 |
| MW: | 219.3 D |
ab 61,00 €
