Zu "139667-74-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
CGP52432
Artikelnummer: TGM-T4363-10mg
Description: CGP52432 is a very potent antagonist of GABAB receptors (IC50 = 85 nM). Target: GABA Receptor. Smiles: C(NCCCP(C(OCC)OCC)(=O)O)C1=CC(Cl)=C(Cl)C=C1. References: Bonanno G,etal.GABA(B) receptors as potential targets for drugs able to prevent excessive excitatory amino acid transmission in the spinal...
| Schlagworte: | CGP 52432 |
| Anwendung: | GABA(B) receptor antagonist |
| CAS | 139667-74-6 |
| MW: | 384.24 D |
ab 34,00 €
CGP 52432
Artikelnummer: Cay27212-10
CGP 52432 is an antagonist of GABAB receptors. It selectively reverses (-)-baclofen-induced inhibition of potassium-evoked GABA release over glutamate or somatostatin release (IC50s = 0.085, 3.35, and 9.26 µM, respectively) from rat cortical synaptosomes. CGP 52432 (10 µM) reduces paired-pulse inhibition of...
| Schlagworte: | P-[3-[[(3,4-dichlorophenyl)methyl]amino]propyl]-P-(diethoxymethyl)-phosphinic acid |
| Anwendung: | GABA(B) receptor antagonist |
| CAS | 139667-74-6 |
| MW: | 384.2 D |
ab 166,00 €
