Zu "139110-80-8" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Zanamivir
Artikelnummer: Cay15123-5
Zanamivir is an inhibitor of influenza neuraminidase. It inhibits neuraminidase activity in clinical isolates of influenza A subtypes H1N1 and H3N2 and influenza B (geometric mean IC50s = 0.73, 1.64, and 11.21 nM, respectively). Zanamivir inhibits replication of influenza A and B in isolated human respiratory...
| Schlagworte: | GG 167, GR 121167X,... |
| Anwendung: | Neuraminidase inhibitor, antiviral agent |
| CAS | 139110-80-8 |
| MW: | 332.3 D |
ab 45,00 €
Zanamivir
Artikelnummer: LKT-Z0252.100
An influenza viral neuraminidase inhibitor. It is a structural analog of sialic acid. It is used in both the treatment and prophylaxis of influenze caused by influenza A virus and influenza B virus.
| Schlagworte: | 5-acetamido- 4-guanidino- 6-(1,2,3-trihydroxypropyl)- 5,6-dihydro- 4H-pyran- 2-carboxylic acid |
| Anwendung: | Neuraminidase inhibitor |
| CAS | 139110-80-8 |
| MW: | 332,31 D |
ab 164,00 €
Zanamivir
Artikelnummer: TGM-T2529-100mg
Description: Zanamivir (GG167) is a guanido-neuraminic acid that is used to inhibit NEURAMINIDASE. Target: Antibiotic, Influenza Virus. Smiles: N(C(C)=O)[C@H]1[C@]([C@@H]([C@@H](CO)O)O)(OC(C(O)=O)=C[C@@H]1NC(=N)N)[H]. References: Gubareva LV, et al. J Infect Dis, 1998, 178(6), 1592-1596.
| Schlagworte: | GG167 |
| Anwendung: | Targets Influenza A/B virus neuraminidase [EC:3.2.1.18] (NA) |
| CAS | 139110-80-8 |
| MW: | 332.31 D |
ab 45,00 €
