Zu "1373215-15-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
LY 3000328
Artikelnummer: TGM-TQ0116-100mg
Description: LY 3000328 (Cathepsin S inhibitor) is a potent, highly selective Cathepsin S (Cat S) inhibitor (IC50s: 7.7 and 1.67 nM for hCat S and mCat S). Target: Cysteine Protease. Smiles: CNC(=O)O[C@H]1COc2ccc(cc2[C@@H]1NC(=O)c1ccc(F)cc1)N1CCN(CC1)C1COC1. References: Jadhav PK, et al. Discovery of Cathepsin S...
| Schlagworte: | Cathepsin S inhibitor |
| Anwendung: | Potent cathepsin S inhibitor |
| CAS | 1373215-15-6 |
| MW: | 484.52 D |
ab 97,00 €
LY3000328
Artikelnummer: Cay29729-10
LY3000328 is a potent cathepsin S inhibitor (IC50 = 7.7 nM for the human enzyme). It is selective for cathepsin S over cathepsin L, K, B, and V (IC50s = >10,000, >10,000, 4,390, and 21,500 nM, respectively). LY3000328 (1-30 mg/kg) reduces aortic diameter in a mouse model of calcium chloride-induced abdominal aortic...
| Schlagworte: | N-[(3R,4S)-3,4-dihydro-3-[[(methylamino)carbonyl]oxy]-6-[4-(3-oxetanyl)-1-piperazinyl]-2H-1-benzopyran-4-yl]-4-fluoro-benz... |
| Anwendung: | Potent cathepsin S inhibitor |
| CAS | 1373215-15-6 |
| MW: | 484.5 D |
ab 111,00 €
