Zu "1372540-25-4" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
GSK2636771
Artikelnummer: TGM-T2073-100mg
Description: GSK2636771, an effective, specific, orally bioavailable, PI3Kbeta inhibitor, has been used in cancer, lymphoma, solid neoplasm, recurrent solid neoplasm, and advanced malignant neoplasm. Target: PI3K. Smiles: Cc1nc2c(cc(cc2n1Cc1cccc(c1C)C(F)(F)F)N1CCOCC1)C(O)=O. References: Macauley D, et al. Drugs Fut,...
| Schlagworte: | GSK 2636771, GSK-2636771 |
| Anwendung: | PIK3CB inhibitor |
| CAS | 1372540-25-4 |
| MW: | 433.42 D |
ab 37,00 €
GSK2636771
Artikelnummer: Cay17380-1
Phosphatidylinositol 3-kinase (PI3K) catalyzes the phosphorylation of phosphatidylinositol at the 3 position to produce the second messengers phosphatidylinositol-3,4-bisphosphate (PtdIns-(3,4)-P2 and PtdIns-(3,4,5)-P3). Class 1 PI3Ks are composed of a p110 catalytic subunit, of which there are four isoforms...
| Schlagworte: | 2-methyl-1-[[2-methyl-3-(trifluoromethyl)phenyl]methyl]-6-(4-morpholinyl)-1H-benzimidazole-4-carboxylic acid |
| Anwendung: | PIK3CB inhibitor |
| CAS | 1372540-25-4 |
| MW: | 433.4 D |
ab 35,00 €
GSK-2636771
Artikelnummer: LKT-G7346.1
p110beta PI3K inhibitor.
| Schlagworte: | GSK-2636771, 2-methyl-1-(2-methyl-3-(trifluoromethyl)benzyl)-6-morpholino-1H-benzo[d]imidazole-4-carboxylic acid |
| Anwendung: | p110beta PI3K inhibitor |
| CAS | 1372540-25-4 |
| MW: | 433.42 D |
ab 116,00 €
