Zu "137201-62-8" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Spinorphin
Artikelnummer: TGM-T8455-100mg
Description: Spinorphin is a heptapeptide, and is a potent enkephalin-degrading enzymes inhibitor. Target: Opioid Receptor. Smiles: CC(C)C[C@H](N)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC1=CC=C(O)C=C1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CC1=CNC2=CC=CC=C12)C(=O)N[C@@H]([C@@H](C)O)C(O)=O. References: Ayar A ,...
| Anwendung: | Enkephalin-degrading enzyme inhibitor |
| CAS | 137201-62-8 |
| MW: | 877 D |
ab 135,00 €
Spinorphin, bovine
Artikelnummer: LKT-S6134.25
An endogenous factor that exhibits inhibitory effects on enkephalin-degrading enzymes.
| Anwendung: | Enkephalinase studies |
| CAS | 137201-62-8 |
| MW: | 877,06 D |
ab 323,00 €
COVID-19 Forschung
Spinorphin
Artikelnummer: Cay29914-1
Spinorphin is a heptapeptide inhibitor of the enkephalin-degrading enzymes aminopeptidase, dipeptidyl aminopeptidase, angiotensin-converting enzyme (ACE), and enkephalinase (IC50s = 3.3, 1.4, 2.4, and 10 µg/ml, respectively, for the monkey brain enzymes). It is selective for these enzymes over human serum...
| Schlagworte: | Leu-Val-Val-Tyr-Pro-Trp-Thr, LVVYPWT, L-leucyl-L-valyl-L-valyl-L-tyrosyl-L-prolyl-L-tryptophyl-L-threonine |
| Anwendung: | Enkephalin-degrading enzyme inhibitor |
| CAS | 137201-62-8 |
| MW: | 877 D |
ab 94,00 €
