Zu "1363421-46-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
MOMIPP
Artikelnummer: TGM-T33467-100mg
Description: MOMIPP is a PIKfyve inhibitor and a macropinocytosis inducer. MOMIPP readily penetrates the blood-brain barrier and is moderately effective in suppressing progression of intracerebral glioblastoma xenografts[1][2]. Target: PI3K. Smiles: COc1ccc2[nH]c(C)c(\C=C\C(=O)c3ccncc3)c2c1. References: Margaux...
| Anwendung: | PIKfyve inhibitor |
| CAS | 1363421-46-8 |
| MW: | 292.33 D |
ab 116,00 €
MOMIPP
Artikelnummer: Cay39671-100
MOMIPP is an inhibitor of PIKfyve (IC50 = 5.05 nM). It selectively binds to PIKfyve over phosphatidylinositol 4-phosphate 5-kinase type-1 gamma (PIP5K1C, Kds = 5.3 and >15,000 nM, respectively). MOMIPP (10 µM) induces vacuolization and cell lysis, markers of methuosis, and decreases the extracellular acidification...
| Schlagworte: | (2E)-3-(5-methoxy-2-methyl-1H-indol-3-yl)-1-(4-pyridinyl)-2-propen-1-one |
| Anwendung: | PIKfyve inhibitor |
| CAS | 1363421-46-8 |
| MW: | 292.3 D |
ab 53,00 €
