Zu "1356962-20-3" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
AZD-3463
Artikelnummer: TGM-T1967-100mg
Description: AZD-3463 (ALK/IGF1R inhibitor), an orally bioavailable ALK inhibitor (Ki: 0.75 nM), can inhibit IGF1R with equivalent potency. Target: ALK, Apoptosis, Autophagy, IGF-1R. Smiles: COc1cc(ccc1Nc1ncc(Cl)c(n1)-c1c[nH]c2ccccc12)N1CCC(N)CC1. References: 104th AACR meeting, 2013, Abst 919.
| Schlagworte: | ALK/IGF1R inhibitor |
| Anwendung: | ALK inhibitor, IGF1R inhibitor |
| CAS | 1356962-20-3 |
| MW: | 448.95 D |
ab 48,00 €
AZD 3463
Artikelnummer: Cay26172-1
AZD 3463 is an inhibitor of anaplastic lymphoma kinase (ALK) and the insulin growth factor-1 receptor (IGF-1R). It inhibits ALK with an IC50 value of 15 nM. It inhibits the proliferation of neuroblastoma cells with wild-type (WT) ALK (IC50s = 2.8-21.3 µM) and ALK with the activating mutations ALKF1174L and ALKD1091N...
| Schlagworte: | N-[4-(4-amino-1-piperidinyl)-2-methoxyphenyl]-5-chloro-4-(1H-indol-3-yl)-2-pyrimidinamine |
| Anwendung: | ALK inhibitor, IGF1R inhibitor |
| CAS | 1356962-20-3 |
| MW: | 449 D |
ab 44,00 €
AZD3463
Artikelnummer: LKT-A9600.1
AZD-3463 is a ALK/IGF1R inhibitor.
| Schlagworte: | AZD-3463, N-(4-(4-aminopiperidin-1-yl)-2-methoxyphenyl)-5-chloro-4-(1H-indol-3-yl)pyrimidin-2-amine |
| Anwendung: | ALK / IGF1R inhibitor |
| CAS | 1356962-20-3 |
| MW: | 448.95 D |
ab 113,00 €
