Zu "1350653-20-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Vericiguat
Artikelnummer: TGM-T17226-100mg
Description: Vericiguat (BAY1021189) is a potent and orally available guanylate cyclase stimulator. Target: Guanylate cyclase. Smiles: COC(=O)Nc1c(N)nc(nc1N)-c1nn(Cc2ccccc2F)c2ncc(F)cc12. References: Follmann M, et al. Discovery of the Soluble Guanylate Cyclase Stimulator Vericiguat (BAY 1021189) for the Treatment...
| Schlagworte: | BAY1021189 |
| Anwendung: | Targets guanylate cyclase soluble subunit alpha [EC:4.6.1.2] (GUCY1A) |
| CAS | 1350653-20-1 |
| MW: | 426.38 D |
ab 42,00 €
Vericiguat
Artikelnummer: Cay35253-10
Vericiguat is a stimulator of soluble guanylyl cyclase (sGC). It stimulates the formation of cGMP in CHO cells expressing recombinant rat sGC in the absence and presence of the nitric oxide (NO) donor SNAP (Cay-82250, EC50s = 1,005 and 39 nM, respectively), an effect that can be reversed by the sGC inhibitor ODQ...
| Schlagworte: | BAY-1021189, MK-1242,... |
| Anwendung: | Soluble guanylyl cyclase stimulator |
| CAS | 1350653-20-1 |
| MW: | 426.4 D |
ab 91,00 €
