Zu "1346572-63-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
GSK503
Artikelnummer: TGM-T1775-100mg
Description: GSK-503, a potent EZH2 inhibitor, has potential antitumor activity. Target: Histone Methyltransferase. Smiles: CC(C)n1cc(C)c2c(cc(cc12)-c1ccc(nc1)N1CCN(C)CC1)C(=O)NCc1c(C)cc(C)[nH]c1=O. References: Béguelin W, et al. Cancer Cell. 2013, 23(5), 677-692
| Anwendung: | EZH2 inhibitor |
| CAS | 1346572-63-1 |
| MW: | 526.67 D |
ab 34,00 €
GSK503
Artikelnummer: Cay18531-1
The lysine methyltransferase EZH2 (KMT6), part of the polycomb repressive complex 2, catalyzes trimethylation of lysine 27 on histone H3 (H3K27me3) and is involved in proliferation and aggressive cell growth associated with neoplastic cells. GSK503 is an inhibitor of EZH2 that prevents the methyltransferase activity...
| Schlagworte: | N-[(1,2-dihydro-4,6-dimethyl-2-oxo-3-pyridinyl)methyl]-3-methyl-1-(1-methylethyl)-6-[6-(4-methyl-1-piperazinyl)-3-pyridiny... |
| Anwendung: | EZH2 inhibitor |
| CAS | 1346572-63-1 |
| MW: | 526.7 D |
ab 44,00 €
