Zu "134308-13-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Tolcapone
Artikelnummer: TGM-T6708-100mg
Description: Tolcapone (Ro 40-7592) is a catechol-O-methyltransferase inhibitor employed as an adjunctive therapy with levodopa and carbidopa in the treatment of Parkinson's disease. Target: Apoptosis, Transferase, Beta Amyloid. Smiles: C(=O)(C1=CC(N(=O)=O)=C(O)C(O)=C1)C2=CC=C(C)C=C2. References: Zürcher G, et al....
| Schlagworte: | Ro 40-7592, Tasmar |
| Anwendung: | Targets catechol O-methyltransferase [EC:2.1.1.6] (COMT) |
| CAS | 134308-13-7 |
| MW: | 273.24 D |
ab 33,00 €
Tolcapone
Artikelnummer: Cay20768-5
Tolcapone is a reversible inhibitor of catechol-O-methyltransferase (COMT, Ki = 0.27 nM for human recombinant COMT), an enzyme that degrades catecholamines, including dopamine and L-DOPA (Cay-13248). Tolcapone crosses the blood brain barrier and can inhibit both peripheral and central COMT activity. By inhibiting...
| Schlagworte: | Ro 40-7592, (3,4-dihydroxy-5-nitrophenyl)(4-methylphenyl)-methanone |
| Anwendung: | Reversible COMT inhibitor |
| CAS | 134308-13-7 |
| MW: | 273.2 D |
ab 53,00 €
