Zu "134234-12-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Traxoprodil
Artikelnummer: TGM-TQ0233-10mg
Description: Traxoprodil (CP101606) is a selective NMDA antagonist and protects hippocampal neurons (IC50: 10 nM). Target: NMDAR, iGluR. Smiles: OC1(CCN([C@H]([C@@H](O)C2=CC=C(O)C=C2)C)CC1)C3=CC=CC=C3. References: Chenard BL, et al. (1S,2S)-1-(4-hydroxyphenyl)-2-(4-hydroxy-4-phenylpiperidino)-1-propanol: a potent...
| Schlagworte: | CP101606 |
| CAS | 134234-12-1 |
| MW: | 327.42 D |
ab 46,00 €
(+)-CP 101,606
Artikelnummer: Cay23884-10
CP 101,606 is a noncompetitive antagonist of NMDA receptors containing the NR2B subunit (Kd = 4.2 nM). CP 101,606 is highly selective for NR1/NR2B-containing NMDA receptors over NR1, NR2A, and NR2B subunits alone and NR1/NR2A receptors in HEK293 cell homogenates. In vivo, CP 101,606 (30 mg/kg, s.c.) inhibits...
| Schlagworte: | CP 98,113, 4-hydroxy-alphaS-(4-hydroxyphenyl)-betaS-methyl-4-phenyl-1-piperidineethanol |
| CAS | 134234-12-1 |
| MW: | 327.4 D |
ab 99,00 €
