Zu "134036-53-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
AG-370
Artikelnummer: TGM-T21784-10mg
Description: AG 370, an indole tyrphostin, is a potent inhibitor of PDGF-induced mitogenesis with an IC50 of 20 µM, and it shows weak inhibition of the EGF receptor. Target: Others. Smiles: C(=C(C(=C(C#N)C#N)N)C#N)C=1C=C2C(=CC1)NC=C2
| CAS | 134036-53-6 |
| MW: | 259.27 D |
ab 140,00 €
AG-370
Artikelnummer: Cay10010568-5
Protein tyrosine kinase (PTK) inhibitors are potential antiproliferative agents for diseases caused by the hyperactivity of PTKs. Tyrphostins are a class of antiproliferative compounds which selectively inhibit PTKs of key growth factors such as epidermal growth factor (EGF) or platelet-derived growth factor (PDGF)...
| Schlagworte: | NSC 651712, 3-amino-4-(1H-indol-5-ylmethylene)-2-pentenetricarbonitrile |
| Anwendung: | PDGF receptor kinase inhibitor |
| CAS | 134036-53-6 |
| MW: | 259.3 D |
ab 77,00 €
