Zu "134036-52-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
(E/Z)-AG490
Artikelnummer: TGM-T60624-200mg
Description: (E/Z)-AG490 ((E/Z)-Tyrphostin AG490) is a racemic compound comprising the isomers (E)-AG490 and (Z)-AG490. (E)-AG490 functions as a tyrosine kinase inhibitor, targeting EGFR, Stat-3, and JAK2/3. Target: Others. Smiles: C(=C(C(NCC1=CC=CC=C1)=O)C#N)C2=CC(O)=C(O)C=C2
| Anwendung: | PDGF receptor autophosphorylation inhibitor |
| CAS | 134036-52-5 |
| MW: | 294.3 D |
1.229,00 €
Tyrphostin AG490
Artikelnummer: LKT-T9969.10
A selective PDGF receptor autophosphorylation inhibitor.
| Schlagworte: | Tyrphostin B42 |
| Anwendung: | PDGF receptor autophosphorylation inhibitor |
| CAS | 134036-52-5 |
| MW: | 294,31 D |
ab 187,00 €
