Zu "1338545-07-5" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
OTS964 hydrochloride
Artikelnummer: TGM-T4135-100mg
Description: OTS964 hydrochloride (OTS964) is a potent and selective TOPK inhibitor with potential anticancer activity. Target: CDK, Apoptosis, TOPK. Smiles: Cl.C[C@@H](CN(C)C)c1ccc(cc1)-c1c(O)cc(C)c2[nH]c(=O)c3sccc3c12. References: Matsuo Y, et al. TOPK inhibitor induces complete tumor regression in xenograft...
| Schlagworte: | OTS964 |
| Anwendung: | PBK / TOPK inhibitor |
| CAS | 1338545-07-5 |
| MW: | 428.97 D |
ab 40,00 €
OTS964 (hydrochloride)
Artikelnummer: Cay17052-5
OTS964 is an inhibitor of lymphokine-activated killer T cell-originated protein kinase (TOPK, IC50 = 28 nM). It specifically blocks cytokinesis, leading to apoptosis, in a broad range of cancer cells. OTS964 induces apoptosis of human lung cancer cells in mouse xenografts.Formal Name:...
| Schlagworte: | 9-[4-[(1R)-2-(dimethylamino)-1-methylethyl]phenyl]-8-hydroxy-6-methyl-thieno[2,3-c]quinolin-4(5H)-one, monohydrochloride |
| Anwendung: | PBK / TOPK inhibitor |
| CAS | 1338545-07-5 |
| MW: | 429 D |
ab 67,00 €
OTS-964
Artikelnummer: LKT-O783720.25
inhibitor of T-lymphokine-activated killer cell-originated protein kinase (TOPK).
| Anwendung: | TOPK inhibitor |
| CAS | 1338545-07-5 |
| MW: | 378.49 D |
ab 189,00 €
