Zu "1321514-06-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
AZD4635
Artikelnummer: TGM-T4265-100mg
Description: AZD4635 (HTL1071) is a new-type adenosine 2A receptor (A2AR) inhibitor(Ki=1.7 nM). Target: Adenosine Receptor. Smiles: Cc1cc(cc(Cl)n1)-c1nnc(N)nc1-c1ccc(F)cc1. References: Alexandra Borodovsky, et al. Abstract 5580: PreClinicalal pharmacodynamics and antitumor activity of AZD4635, a novel adenosine 2A...
| Schlagworte: | HTL1071 |
| Anwendung: | Adenosine 2A receptor (A2AR) antagonist |
| CAS | 1321514-06-0 |
| MW: | 315.73 D |
ab 31,00 €
AZD 4635
Artikelnummer: Cay26322-10
AZD 4635 is an adenosine A2 receptor antagonist (Ki = 1.7 nM for the human receptor). It inhibits adenosine-induced cAMP production in CHO cells expressing the human A2 receptor (IC50 = 0.79 µM) and reverses suppression of IFN-gamma secretion induced by 5'-N-ethylcarboxamidoadenosine (NECA, Cay-21420) in CD8+ T...
| Schlagworte: | HTL-1071, 6-(2-chloro-6-methyl-4-pyridinyl)-5-(4-fluorophenyl)-1,2,4-triazin-3-amine |
| Anwendung: | Adenosine 2A receptor (A2AR) antagonist |
| CAS | 1321514-06-0 |
| MW: | 315.7 D |
ab 184,00 €
