Zu "132-69-4" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Benzydamine hydrochloride
Artikelnummer: TGM-T0726-100mg
Description: Benzydamine hydrochloride (AF864), a locally-acting nonsteroidal anti-inflammatory drug, has local anaesthetic and analgesic properties. Target: COX, Antibacterial, PGE Synthase. Smiles: Cl.CN(C)CCCOc1nn(Cc2ccccc2)c2ccccc12. References: Epstein JB, et al. Int J Radiat Oncol Biol Phys, 1989, 16(6),...
| Schlagworte: | AF864, Benzydamine HCl |
| CAS | 132-69-4 |
| MW: | 345.87 D |
ab 34,00 €
Benzydamine Hydrochloride
Artikelnummer: LKT-B1640.25
NSAID, PG synthetase inhibitor.
| Schlagworte: | Benzindamine hydrochloride, N,N-Dimethyl-3-[[1-(phenylmethl)-1H-indazol-3-yl]oxy]-1-propanamine hydrochloride |
| Anwendung: | Anti-inflammatory agent |
| CAS | 132-69-4 |
| MW: | 345,87 D |
ab 85,00 €
Benzydamine (hydrochloride)
Artikelnummer: Cay39808-10
Benzydamine is a non-steroidal anti-inflammatory drug (NSAID). It decreases the viability of THP-1 monocytes, Saos-2 osteosarcoma, and HGF-1 gingival cancer cells (IC50s = 59.08, 30.79, and 52.06 µg/ml, respectively). Benzydamine (10 µg/ml) reduces LPS-induced increases in the levels of IL-6 and TNF-alpha secreted...
| Schlagworte: | N,N-dimethyl-3-[[1-(phenylmethyl)-1H-indazol-3-yl]oxy]-1-propanamine, monohydrochloride |
| Anwendung: | NSAID, COX inhibitor |
| CAS | 132-69-4 |
| MW: | 345.9 D |
ab 40,00 €
