Zu "131631-89-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Fuscoside
Artikelnummer: TGM-T4355-100mg
Description: Fuscoside (OPC 21268) is a non-peptide Arginine vasopressin(AVP) Receptor V antagonist. Target: Vasopressin Receptor. Smiles: CC(=O)NCCCOc1ccc(cc1)C(=O)N1CCC(CC1)N1C(=O)CCc2ccccc12. References: Yamamura Y,etal.PC-21268, an orally effective, nonpeptide vasopressin V1 receptor antagonist.Science. 1991 Apr...
| Schlagworte: | OPC 21268 |
| Anwendung: | Vasopressin V1a/b receptor antagonist |
| CAS | 131631-89-5 |
| MW: | 449.54 D |
ab 52,00 €
OPC 21268
Artikelnummer: Cay27226-10
OPC 21268 is a nonpeptide antagonist of vasopressin V1 receptors (IC50 = 0.4 µM in rat liver membranes). It is selective for V1 over V2 receptors (IC50 = >100 µM in kidney membranes). It is also selective for rat over human V1 receptors (Kis = 25 and 8,800 nM, respectively), which can be partially attributed to the...
| Schlagworte: | N-[3-[4-[[4-(3,4-dihydro-2-oxo-1(2H)-quinolinyl)-1-piperidinyl]carbonyl]phenoxy]propyl]-acetamide |
| Anwendung: | Vasopressin V1a/b receptor antagonist |
| CAS | 131631-89-5 |
| MW: | 449.5 D |
ab 209,00 €
