Zu "1303607-60-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
SAR405838
Artikelnummer: TGM-T6585-100mg
Description: MI-773 (SAR405838 (MI 773)) is an orally available MDM2 antagonist with Ki of 0.88 nM. Phase 1. Target: E1/E2/E3 Enzyme, Mdm2. Smiles: CC(C)(C)C[C@@H]1N[C@H]([C@H](c2cccc(Cl)c2F)[C@]11C(=O)Nc2cc(Cl)ccc12)C(=O)N[C@H]1CC[C@H](O)CC1. References: Wang S, et al. Cancer Res. 2014, 74(20), 5855-5865.
| Schlagworte: | MI-77301, MI-773, MI773, MI 773 |
| Anwendung: | MDM2-p53 interaction inhibitor |
| CAS | 1303607-60-4 |
| MW: | 562.5 D |
ab 45,00 €
MI-77301
Artikelnummer: Cay17473-1
The protein p53, often called the 'guardian of the genome,' is a transcription factor that is activated in response to cellular stress (low oxygen levels, heat shock, DNA damage, etc.) and acts to prevent further proliferation of the stressed cell by promoting cell cycle arrest or apoptosis. Its role as a tumor...
| Schlagworte: | SAR405838,... |
| Anwendung: | MDM2-p53 interaction inhibitor |
| CAS | 1303607-60-4 |
| MW: | 562.5 D |
ab 60,00 €
