Zu "1265229-25-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Zoligratinib
Artikelnummer: TGM-T6024-100mg
Description: Zoligratinib (CH5183284) is a selective and orally available FGFR inhibitor, which is for FGFR1(IC50=9.3 nM), FGFR2(IC50=7.6 nM), FGFR3(IC50=290), and FGFR4(IC50=22 nM), respectively. Target: FGFR. Smiles: Cc1nc2ccc(cc2[nH]1)-n1ncc(C(=O)c2cc3ccccc3[nH]2)c1N. References: Nakanishi Y, et al. Mol Cancer...
| Schlagworte: | FF284, CH5183284, Debio 1347 |
| Anwendung: | FGFR1/2/3 inhibitor |
| CAS | 1265229-25-1 |
| MW: | 356.38 D |
ab 41,00 €
CH5183284
Artikelnummer: Cay17120-1
CH5183284 is a potent, selective inhibitor of the kinase activity of fibroblast growth factor receptors (FGFRs) 1, 2, and 3 (IC50s = 9.3, 7.6, and 22 nM, respectively). It less potently inhibits FGFR4 and platelet-derived growth factor receptor beta (IC50s = 290 and 560 nM, respectively) and displays IC50 values...
| Schlagworte: | Debio 1347, [5-amino-1-(2-methyl-1H-benzimidazol-6-yl)-1H-pyrazol-4-yl]-1H-indol-2-yl-methanone |
| Anwendung: | FGFR1/2/3 inhibitor |
| CAS | 1265229-25-1 |
| MW: | 356.4 D |
ab 67,00 €
