Zu "126411-39-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
SR12813
Artikelnummer: TGM-T6994-100mg
Description: SR12813 (GW 485801) is a pregnane X receptor (PXR) agonist. Target: HMG-CoA Reductase, Autophagy. Smiles: P(C(P(OCC)(OCC)=O)=CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1)(OCC)(OCC)=O. References: Jones SA, et al. Mol Endocrinol. 2000, 14(1):27-39.
| Schlagworte: | GW 485801, SR 12813, SR-12813 |
| Anwendung: | HMG-CoA reductase degradation enhancer, pregnane X receptor ligand |
| CAS | 126411-39-0 |
| MW: | 504.53 D |
ab 50,00 €
SR-12813
Artikelnummer: Cay18115-10
SR-12813 is a 1,1-bisphosphonate ester that exhibits hypocholesterolemic activity by enhancing the degradation of HMG-CoA reductase in various animal models. SR-12813 is also a high affinity ligand for human and rabbit pregnane X receptors (Kd = 41 nM, EC50 = 137 nM for hPXR in vitro) and can induce cytochrome P450...
| Schlagworte: | GW 485801, P,P'-[[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]ethenylidene]bis-phosphonic acid P,P,P',P'-tetraethyl ester |
| Anwendung: | HMG-CoA reductase degradation enhancer, Pregnane X receptor ligand |
| CAS | 126411-39-0 |
| MW: | 504.5 D |
ab 115,00 €
