Zu "1258861-20-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Taladegib
Artikelnummer: TGM-T2666-100mg
Description: Taladegib (LY2940680) is an orally bioavailable small molecule antagonist of the Hedgehog (Hh)-ligand cell surface receptor smoothened (Smo) with potential antineoplastic activity. Target: Smo, Hedgehog/Smoothened. Smiles: CN(C1CCN(CC1)c1nnc(-c2ccnn2C)c2ccccc12)C(=O)c1ccc(F)cc1C(F)(F)F. References:...
| Schlagworte: | LY2940680 |
| CAS | 1258861-20-9 |
| MW: | 512.5 D |
ab 41,00 €
LY2940680
Artikelnummer: Cay16264-1
LY2940680 is a smoothened (Smo) antagonist. It inhibits [35S]GTPgammaS binding in CHO cells expressing wild-type Smo (IC50 = 294 nM) and reduces production of GLI1 mRNA induced by sonic hedgehog (Shh) in Daoy cells (IC50 = 5.49 nM). Topical application of LY2940680 (2% w/v) decreases skin GLI1 and PTCH1 mRNA...
| Schlagworte: | Taladegib, 4-fluoro-N-methyl-N-[1-[4-(1-methyl-1H-pyrazol-5-yl)-1-phthalazinyl]-4-piperidinyl]-2-(trifluoromethyl)-benzamide |
| Anwendung: | Smo inhibitor |
| CAS | 1258861-20-9 |
| MW: | 512.5 D |
ab 82,00 €
