Zu "1246638-08-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
N-Demethyl ivabradine hydrochloride
Artikelnummer: TGM-T11695-10mg
Description: N-Demethyl Ivabradine HCl is a specific inhibitor of the funny channel and a metabolite of Ivabradine. Target: Others. Smiles: Cl.COc1cc2C[C@H](CNCCCN3CCc4cc(OC)c(OC)cc4CC3=O)c2cc1OC
| Schlagworte: | Ivabradine metabolite N-Demethyl Ivabradine hydrochloride |
| CAS | 1246638-08-3 |
| MW: | 491.02 D |
ab 140,00 €
N-desmethyl Ivabradine (hydrochloride)
Artikelnummer: Cay27808-1
N-desmethyl Ivabradine is an active metabolite of ivabradine (Cay-15868). Ivabradine is metabolized by the cytochrome P450 (CYP) isoform CYP3A4.Formal Name: 3-[3-[[[(7S)-3,4-dimethoxybicyclo[4.2.0]octa-1,3,5-trien-7-yl]methyl]amino]propyl]-1,3,4,5-tetrahydro-7,8-dimethoxy-2H-3-benzazepin-2-one, monohydrochloride....
| Schlagworte: | 3-[3-[[[(7S)-3,4-dimethoxybicyclo[4.2.0]octa-1,3,5-trien-7-yl]methyl]amino]propyl]-1,3,4,5-tetrahydro-7,8-dimethoxy-2H-3-b... |
| Anwendung: | Active metabolite |
| CAS | 1246638-08-3 |
| MW: | 491 D |
ab 77,00 €
