Zu "1215281-19-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
YK-3-237
Artikelnummer: TGM-T9320-100mg
Description: YK-3-237 (B-[2-Methoxy-5-[(1E)-3-oxo-3-(3,4,5-trimethoxyphenyl)-1-propen-1-yl]phenyl]boronic acid) reduces acetylation of mtp53 and exhibits anti-proliferative effects toward triple-negative breast cancer (TNBC) cells carrying mtp53. Target: Sirtuin. Smiles: COc1ccc(\C=C\C(=O)c2cc(OC)c(OC)c(OC)c2)cc1B(O)O
| Schlagworte: | B-[2-Methoxy-5-[(1E)-3-oxo-3-(3,4,5-trimethoxyphenyl)-1-propen-1-yl]phenyl]boronic acid |
| Anwendung: | SIRT1 activator |
| CAS | 1215281-19-8 |
| MW: | 372.18 D |
ab 34,00 €
YK-3-237
Artikelnummer: Cay21516-10
YK-3-237 is a chalcone derivative and an activator of sirtuin 1 (SIRT1). It inhibits colchicine binding to tubulin in a concentration-dependent manner and tubulin polymerization (IC50 = 31 µM) and induces microtubule loss in A-10 cells (EC50 = 16.5 µM). YK-3-237 inhibits cell growth in a panel of leukemia, non-small...
| Schlagworte: | B-[2-methoxy-5-[(1E)-3-oxo-3-(3,4,5-trimethoxyphenyl)-1-propen-1-yl]phenyl]-boronic acid |
| Anwendung: | SIRT1 activator |
| CAS | 1215281-19-8 |
| MW: | 372.2 D |
ab 43,00 €
