Zu "120635-25-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Mofegiline hydrochloride
Artikelnummer: TGM-T12088-10mg
Description: Mofegiline hydrochloride is a potent and selective enzyme-activated irreversible MAO-B inhibitor. Target: Others. Smiles: Cl.NC\C(CCc1ccc(F)cc1)=C\F. References: Zreika M, et al. MDL 72,974: a potent and selective enzyme-activated irreversible inhibitor of monoamine oxidase type B with potential for use...
| Schlagworte: | MDL72974A |
| Anwendung: | Targets monoamine oxidase [EC:1.4.3.4] (MAO, aofH) |
| CAS | 120635-25-8 |
| MW: | 233.69 D |
ab 52,00 €
Mofegiline (hydrochloride)
Artikelnummer: Cay35010-25
Mofegiline is an inhibitor of monoamine oxidase B (MAO-B, IC50 = 3.6 nM for the rat brain mitochondrial enzyme). It is selective for MAO-B over MAO-A (IC50 = 680 nM). Mofegiline also inhibits vascular adhesion protein-1 (VAP-1), also known as semicarbazide-sensitive amine oxidase (SSAO), an enzyme that has roles in...
| Schlagworte: | MDL 72974A, 4-fluoro-betaE-(fluoromethylene)-benzenebutanamine, monohydrochloride |
| Anwendung: | MAO-B inhibitor |
| CAS | 120635-25-8 |
| MW: | 233.7 D |
ab 204,00 €
