Zu "1197958-12-5" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
ALK-IN-1
Artikelnummer: TGM-T3059-100mg
Description: ALK-IN-1 (AP26113) is a potent ALK inhibitor with IC50 of 0.62 nM in a cell-free assay, demonstrated ability overcome Crizotinib resistance mediated by a L1196M mutation. Phase 2. Target: ALK, EGFR, IGF-1R. Smiles: N(C1=C(P(C)(C)=O)C=CC=C1)C2=NC(NC3=C(OC)C=C(C=C3)N4CCC(N(C)C)CC4)=NC=C2Cl. References:...
| Schlagworte: | AP26113, Brigatinib, AP26113-analog |
| Anwendung: | ALK inhibitor |
| CAS | 1197958-12-5 |
| MW: | 529.01 D |
ab 40,00 €
ALK-IN-1
Artikelnummer: Cay18775-10
ALK-IN-1 is an analog of AP26113, a phosphine oxide-containing ALK inhibitor. ALK-IN-1 potently inhibits ALK (IC50 = 0.07 nM) over IGF-1R and InsR (IC50s = 3.2 and 100 nM, respectively). It drives cell death in (ALK+) Karpas-299 lymphoma cells with an IC50 value of 41.5 nM, while killing (ALK-) U937 cells with an...
| Schlagworte: | 5-chloro-N2-[4-[4-(dimethylamino)-1-piperidinyl]-2-methoxyphenyl]-N4-[2-(dimethylphosphinyl)phenyl]-2,4-pyrimidinediamine |
| Anwendung: | ALK inhibitor |
| CAS | 1197958-12-5 |
| MW: | 529 D |
ab 75,00 €
AP-26113
Artikelnummer: LKT-A600002.100
| Schlagworte: | Brigatinib Analog, AP26113 |
| Anwendung: | ALK inhibitor |
| CAS | 1197958-12-5 |
| MW: | 529.02 D |
ab 176,00 €
