Zu "1189375-06-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Torsemide-d7
Artikelnummer: TGM-TMIH-0578-1mg
Description: Torsemide-d7 is a deuterated compound of Torsemide. Smiles: [2H]C([2H])([2H])C([2H])(NC(=O)NS(=O)(=O)C1=CN=CC=C1NC1=CC(C)=CC=C1)C([2H])([2H])[2H]
| Anwendung: | GC-MS, LC-MS, quantification, internal standard, diuretic, Na-K-Cl cotransporter inhibitor |
| CAS | 1189375-06-1 |
| MW: | 355.46 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
Torasemide-d7
Artikelnummer: Cay26790-1
Torasemide-d7 is intended for use as an internal standard for the quantification of torasemide by GC- or LC-MS. Torasemide is a loop diuretic. In vivo, torasemide (6 mg/kg) increases fractional potassium, sodium, and chloride excretion and increases urine flow in rats. Formulations containing torsemide have been...
| Schlagworte: | Torsemide-d7, N-[[(1-methylethyl-d7)amino]carbonyl]-4-[(3-methylphenyl)amino]-3-pyridinesulfonamide |
| Anwendung: | GC-MS, LC-MS, Quantification, Internal standard, Diuretic, Na-K-Cl cotransporter inhibitor |
| CAS | 1189375-06-1 |
| MW: | 355.5 D |
ab 125,00 €
