Zu "1185888-32-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
MDMB-CHMINACA
Artikelnummer: TGM-T28006-10mg
Description: MDMB-CHMINACA, an indazole-based synthetic cannabinoid, acts as a potent agonist of the CB1 receptor. Target: Others. Smiles: C(N1C=2C(C(C(N[C@H](C(OC)=O)C(C)(C)C)=O)=N1)=CC=CC2)C3CCCCC3. References: Banister, Samuel D., Longworth, Mitchell, Kevin, Richard, Sachdev, Shivani, Santiago, Marina, Stuart,...
| Schlagworte: | (S)-MDMB-CHMINACA |
| Anwendung: | Indazole-based synthetic cannabinoid (AB-CHMINACA related) |
| CAS | 1185888-32-7 |
| MW: | 385.5 D |
ab 193,00 €
MDMB-CHMINACA
Artikelnummer: Cay16200-1
AB-CHMINACA (Cay-15434) is an indazole-based synthetic cannabinoid (CB) that is structurally related to AB-FUBINACA (Cay-14039), a high affinity ligand of the central CB1 receptor (Ki = 0.9 nM), by having a cyclohexyl group substituted for the 4-fluorophenyl group. MDMB-CHMINACA is structurally related to...
| Schlagworte: | (S)-MDMB-CHMINACA, N-[[1-(cyclohexylmethyl)-1H-indazol-3-yl]carbonyl]-3-methyl-L-valine, methyl ester |
| Anwendung: | Analytical reference standard, Indazole-based synthetic cannabinoid (AB-CHMINACA related) |
| CAS | 1185888-32-7 |
| MW: | 385.5 D |
ab 291,00 €
