Zu "118-08-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Hydrastine
Artikelnummer: TGM-TQ0160-10mg
Description: Hydrastine ((-)-beta-Hydrastine) is a natural alkaloid that is present in Hydrastis Canadensis. Target: Others. Smiles: [H][C@@]1(OC(=O)c2c1ccc(OC)c2OC)[C@]1([H])N(C)CCc2cc3OCOc3cc12
| Schlagworte: | (-)-beta-Hydrastine, (1R,9S)-beta-Hydrastine |
| Anwendung: | Tyrosine hydroxylase inhibitor |
| CAS | 118-08-1 |
| MW: | 383.39 D |
ab 33,00 €
(1R,9S)-(-)-beta-Hydrastine
Artikelnummer: Cay22363-10
(1R,9S)-(-)-beta-Hydrastine is an enantiomer of the alkaloid hydrastine that inhibits dopamine biosynthesis (IC50 = 20.7 µM in PC12 cells) by inhibiting tyrosine hydroxylase activity. It inhibits dopamine release with an IC50 value of 66.5 µM in the presence of high extracellular K+ levels. It also inhibits L-type...
| Schlagworte: | (3S)-6,7-dimethoxy-3-[(5R)-5,6,7,8-tetrahydro-6-methyl-1,3-dioxolo[4,5-g]isoquinolin-5-yl]-1(3H)-isobenzofuranone |
| Anwendung: | Tyrosine hydroxylase inhibitor |
| CAS | 118-08-1 |
| MW: | 383.4 D |
ab 92,00 €
