Zu "1164470-53-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Sal-003
Artikelnummer: Cay23414-5
Sal-003 dose-dependently prevents dephosphorylation of eukaryotic translation initiation factor 2 subunit alpha (eIF2alpha). It is a more potent derivative of salubrinal (Cay-14735) that increases eIF2alpha phosphorylation in mouse embryonic fibroblasts (MEFs) when used at a concentration of 10 µM. It impairs...
| Schlagworte: | (2E)-3-phenyl-N-[2,2,2-trichloro-1-[[[(4-chlorophenyl)amino]thioxomethyl]amino]ethyl]-2-propenamide |
| Anwendung: | EIF2A dephosphorylation inhibitor |
| CAS | 1164470-53-4 |
| MW: | 463.2 D |
ab 133,00 €
Sal003
Artikelnummer: TGM-T2417-100mg
Description: Sal003, an effective cell-permeable analog, inhibitis the eIF2alpha phosphatase. Target: Phosphatase, PERK, Apoptosis. Smiles: Clc1ccc(NC(=S)NC(NC(=O)\C=C\c2ccccc2)C(Cl)(Cl)Cl)cc1. References: Robert F, et al. Mol Biol Cell. 2006, 17(11), 4632-4644.
| CAS | 1164470-53-4 |
| MW: | 463.21 D |
ab 33,00 €
