Zu "1160514-60-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Pyr3
Artikelnummer: TGM-T16687-100mg
Description: Pyr3 is a selective transient receptor potential canonical channel 3 inhibitor. Pyr3 inhibits TRPC3-mediated Ca2+ influx in a dose-dependent manner(IC50 = 700 nM). Target: TRP/TRPV Channel. Smiles: CCOC(=O)c1cnn(c1C(F)(F)F)-c1ccc(NC(=O)C(Cl)=C(Cl)Cl)cc1. References: Kiyonaka S, et al. Selective and...
| Anwendung: | TRPC3 antagonist |
| CAS | 1160514-60-2 |
| MW: | 456.63 D |
ab 31,00 €
Pyr3
Artikelnummer: Cay16888-10
Pyr3 is a pyrazole compound that selectively antagonizes the transient receptor potential canonical channel 3 (TRPC3). It inhibits TRPC3-mediated Ca2+ influx with an IC50 value of 0.7 µM without effect on other TRPC members and suppresses activation of nuclear factor of activated T cells with an IC50 value of 0.05...
| Schlagworte: | 1-[4-[(2,3,3-trichloro-1-oxo-2-propen-1-yl)amino]phenyl]-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid, ethyl ester |
| Anwendung: | TRPC3 antagonist |
| CAS | 1160514-60-2 |
| MW: | 456.6 D |
ab 44,00 €
