Zu "1159576-98-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
CAY10606
Artikelnummer: TGM-T37353-1mg
Description: CAY10606 has a wide range of applications in life science related research. Target: Others. Smiles: CCOC(=O)c1c(Cc2cccc(Cl)c2)[nH]c2c1cc(O)c1ccccc21
| Anwendung: | 5-LO inhibitor |
| CAS | 1159576-98-3 |
| MW: | 379.84 D |
ab 154,00 €
CAY10606
Artikelnummer: Cay13381-1
5-Lipoxygenase (5-LO) initiates the synthesis of leukotrienes (LTs) from arachidonic acid, primarily in certain leukocyte populations. CAY10606 is a potent, reversible inhibitor of 5-LO, both in cell-free assays (IC50 = 86 nM) and in intact neutrophils (IC50 = 230 nM). It prevents the production of LTs in whole...
| Schlagworte: | 2-[(3-chlorophenyl)methyl]-5-hydroxy-1H-benz[g]indole-3-carboxylic acid, ethyl ester |
| Anwendung: | 5-LO inhibitor |
| CAS | 1159576-98-3 |
| MW: | 379.8 D |
ab 85,00 €
