Zu "115956-12-2" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Dolasetron
Artikelnummer: TGM-T4568-100mg
Description: Dolasetron (MDL-73147)(MDL-73147) is a serotonin 5-HT3 receptor antagonist. Dolasetron is used to treat nausea and vomiting following chemotherapy. Target: 5-HT Receptor. Smiles: O=C(O[C@@H]1C[C@H]2C[C@@H]3C[C@@H](C1)N2CC3=O)c1c[nH]c2ccccc12. References: Faria C,etal.Outcomes Associated with 5-HT3-RA...
| Schlagworte: | MDL-73147 |
| Anwendung: | Targets 5-hydroxytryptamine receptor 3 (HTR3) |
| CAS | 115956-12-2 |
| MW: | 324.37 D |
ab 42,00 €
Dolasetron
Artikelnummer: LKT-D5746.100
An antiserotonin used as an antiemetic to prevent nausea and vomiting brought on bygeneral anaesthesia or chemotherapy.
| Anwendung: | Metabolic studies |
| CAS | 115956-12-2 |
| MW: | 324,37 D |
ab 265,00 €
Dolasetron
Artikelnummer: Cay22234-10
Dolasetron is an antagonist of the serotonin (5-HT) receptor subtype 5-HT3 (Ki = 20 nM). It is selective for 5-HT3 receptors over 5-HT1A, 5-HT1B, 5-HT2, dopamine D2, alpha1-, alpha2-, beta-adrenergic, M1-5 muscarinic acetylcholine, and neurokinin-1 (NK1) receptors (IC50s = >10 µM for all). Dolasetron inhibits...
| Schlagworte: | MDL 73147, 1H-indole-3-carboxylic acid, octahydro-3-oxo-2,6-methano-2H-quinolizin-8-yl ester, stereoisomer |
| Anwendung: | 5-HT3-receptor antagonist |
| CAS | 115956-12-2 |
| MW: | 324.4 D |
ab 67,00 €
