Zu "1158-10-7" wurden 1 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
3,5-Diiodothyropropionic acid
3,5-Diiodothyropropionic acid

Artikelnummer: TGM-T13492-10mg

Description: 3,5-Diiodothyropropionic acid (C082182) is a thyroid hormone analog. It induces alpha-myosin heavy chain mRNA expression, binds to thyroid hormone receptor (Ka: 2.40/M and 4.06/M for TRalpha1 and TRbeta1). Target: Thyroid hormone receptor(THR). Smiles: OC(=O)CCc1cc(I)c(Oc2ccc(O)cc2)c(I)c1. References:...
Schlagworte: C082182, Ditpa cpd
Anwendung: Thyroid hormone analogue
CAS 1158-10-7
MW: 510.06 D
ab 40,00 €
Bewerten