Zu "1155877-97-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
D159687
Artikelnummer: TGM-T5474-100mg
Description: D159687 is a selective PDE4D inhibitor,had a procognitive profile as it improved memory in the novel object recognition test but had no antidepressant or anxiolytic benefit. Target: PDE. Smiles: COc1ccc(Cc2ccc(NC(N)=O)cc2)cc1-c1cccc(Cl)c1. References: Zhang C, et al. Comparison of the Pharmacological...
| Schlagworte: | D 159687 |
| Anwendung: | Negative allosteric PDE4D modulator |
| CAS | 1155877-97-6 |
| MW: | 366.84 D |
ab 47,00 €
D159687
Artikelnummer: Cay38778-10
D159687 is a negative allosteric modulator of phosphodiesterase 4D (PDE4D, IC50 = 28 nM for the human enzyme). It is selective for PDE4D over PDE4B (IC50 = 562 nM for the human enzyme), as well as 14 other PDE isoforms (IC50s = >1.4 µM). D159687 decreases forskolin-induced cAMP hydrolysis in HEK293 cells (IC50 = 253...
| Schlagworte: | N-[4-[(3'-chloro-6-methoxy[1,1'-biphenyl]-3-yl)methyl]phenyl]-urea |
| Anwendung: | Negative allosteric PDE4D modulator |
| CAS | 1155877-97-6 |
| MW: | 366.8 D |
ab 88,00 €
