Zu "1154028-82-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Molidustat
Artikelnummer: TGM-T2652-10mg
Description: Molidustat (BAY 85-3934)(BAY-85-3934), an inhibitor of hypoxia-inducible factor (HIF) prolyl hydroxylase (PH), stimulates erythropoietin (EPO) production and the formation of red blood cells. Target: HIF/HIF Prolyl-Hydroxylase. Smiles: O=c1c(c[nH]n1-c1cc(ncn1)N1CCOCC1)-n1ccnn1. References: Flamme I, et...
| Schlagworte: | BAY 85-3934 |
| CAS | 1154028-82-6 |
| MW: | 314.3 D |
ab 45,00 €
BAY 85-3934
Artikelnummer: Cay15297-5
BAY 85-3934 is a pan-inhibitor of hypoxia-inducible factor prolyl hydroxylases (HIF-PH, IC50s = 0.48, 0.28, and 0.45 µM for HIF-PH1, HIF-PH2, and HIF-PH3, respectively). It stabilizes HIF-1alpha and HIF-2alpha levels in HeLa cells in a concentration- and time-dependent manner. BAY 85-3934 (50 µM) induces cell-cycle...
| Schlagworte: | Molidustat, 1,2-dihydro-2-[6-(4-morpholinyl)-4-pyrimidinyl]-4-(1H-1,2,3-triazol-1-yl)-3H-pyrazol-3-one |
| Anwendung: | HIF-1alpha prolyl hydroxylase inhibitor |
| CAS | 1154028-82-6 |
| MW: | 314.3 D |
ab 45,00 €
