Zu "115144-35-9" wurden 7 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
D-Luciferin (potassium salt)
Artikelnummer: Cay14681-1
D-Luciferin is a chemiluminescent substrate of firefly luciferase. It produces light upon oxidative decarboxylation by luciferase in the presence of ATP. D-Luciferin can be employed to assay the expression of the luciferase gene linked to a promoter of interest. Alternatively, D-luciferin and luciferase can be used...
| Schlagworte: | 4,5-dihydro-2-(6-hydroxy-2-benzothiazolyl)-4S-thiazolecarboxylic acid, monopotassium salt |
| Anwendung: | Chemiluminescent firefly luciferase substrate |
| CAS | 115144-35-9 |
| MW: | 318.4 D |
ab 60,00 €
D-Luciferin potassium
Artikelnummer: TGM-T4139-100mg
Description: D-Luciferin potassium (D-Luciferin K Salt) is a popular bioluminescent substrate of luciferase in the presence of ATP. Target: Others. Smiles: [K+].Oc1ccc2nc(sc2c1)C1=N[C@H](CS1)C([O-])=O. References: Hauber R, et al. J Clin Chem Clin Biochem. 1987, 25(8), 511-514.
| Schlagworte: | D-Luciferin K Salt, D-Luciferin Potassium Salt |
| Anwendung: | Bioluminescence assays |
| CAS | 115144-35-9 |
| MW: | 318.41 D |
ab 41,00 €
D-Luciferin, potassium salt *UltraPure Grade*
Artikelnummer: ABD-12506
Luciferin is the most popular and versatile bioluminescent substrate.
| Anwendung: | Bioluminescence assays |
| CAS | 115144-35-9 |
ab 108,00 €
D-Luciferin potassium salt
Artikelnummer: CDX-L0009-M050
Light yellow solid. Soluble in DMSO (10mg/ml) or water (10mg/ml). Chemical. CAS: 115144-35-9. Formula: C11H7KN2O3S2. MW: 318.41. D-Luciferin is the most popular and versatile bioluminescent substrate. Firefly luciferase produces light by the ATP-dependent oxidation (Mg2+ as cofactor) of luciferin. It emits a...
| Schlagworte: | (S)-2-(6-Hydroxy-2-benzothiazolyl)-2-thiazoline-4-carboxylic acid potassium salt,... |
| Anwendung: | Labeling |
| CAS | 115144-35-9 |
| MW: | 318,41 D |
ab 46,00 €
D-Luciferin potassium salt
Artikelnummer: LKT-L8010.5
Protect from light.
| Schlagworte: | 4,5-Dihydro-2-(6-hydroxy-2-benzothiazolyl)-4-thiazolecarboxylic acid potassium salt |
| Anwendung: | Chemiluminescent firefly luciferase substrate |
| CAS | 115144-35-9 |
| MW: | 318.42 D |
ab 117,00 €
Luciferin, Firefly, Potassium Salt...
Artikelnummer: L6007.100
Luciferin is the substrate for luciferase and is used in highly sensitive bioluminescence assays for the detection of ATP, the generation of light is directly proportional to the concentration of ATP. Also used in detection of the luciferase marker gene. Solubility: Methanol, acetone, ethyl acetate, DMF. Slightly...
| CAS | 115144-35-9 |
| MW: | 318.40 D |
ab 228,00 €
(4S)-4,5-Dihydro-2-(6-hydroxy-2-benzothiazolyl)-4-thiazol...
Artikelnummer: 161701.250
| CAS | 115144-35-9 |
454,00 €